C22H44IN5O3 — CID 110044916
ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2,2-dimethylheptyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 110044916) has the molecular formula C22H44IN5O3 and a molecular weight of 553.53 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2,2-dimethylheptyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2,2-dimethylheptyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110044916 |
| Molecular Formula | C22H44IN5O3 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2,2-dimethylheptyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCCCCC(C)(C)CN/C(=N\CC(=O)N(C)C)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C22H43N5O3.HI/c1-7-9-10-13-22(3,4)17-24-20(23-16-19(28)26(5)6)25-18-11-14-27(15-12-18)21(29)30-8-2;/h18H,7-17H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | SCFHYGGVSIDGQU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|