C18H34IN5O3S — CID 110045880
ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(thiolan-2-ylmethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 110045880) has the molecular formula C18H34IN5O3S and a molecular weight of 527.47 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(thiolan-2-ylmethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(thiolan-2-ylmethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110045880 |
| Molecular Formula | C18H34IN5O3S |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(thiolan-2-ylmethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCC2CCCS2)CC1.I |
| InChI | InChI=1S/C18H33N5O3S.HI/c1-4-26-18(25)23-9-7-14(8-10-23)21-17(20-13-16(24)22(2)3)19-12-15-6-5-11-27-15;/h14-15H,4-13H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | YFINIZJYHRIRRH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|