C18H33N5O3S — CID 111862973
ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-prop-2-enylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111862973) has the molecular formula C18H33N5O3S and a molecular weight of 399.56 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-prop-2-enylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-prop-2-enylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111862973 |
| Molecular Formula | C18H33N5O3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-prop-2-enylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | C=CCSCCN/C(=N\CC(=O)N(C)C)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H33N5O3S/c1-5-12-27-13-9-19-17(20-14-16(24)22(3)4)21-15-7-10-23(11-8-15)18(25)26-6-2/h5,15H,1,6-14H2,2-4H3,(H2,19,20,21) |
| InChIKey | CFWHBVJLOJVYJR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|