C13H27IN4OS — CID 111777543
N,N-dimethyl-2-[[(2-prop-2-enylsulfanylethylamino)-(propylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111777543) has the molecular formula C13H27IN4OS and a molecular weight of 414.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-prop-2-enylsulfanylethylamino)-(propylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-prop-2-enylsulfanylethylamino)-(propylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111777543 |
| Molecular Formula | C13H27IN4OS |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N,N-dimethyl-2-[[(2-prop-2-enylsulfanylethylamino)-(propylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCSCCN/C(=N/CC(=O)N(C)C)NCCC.I |
| InChI | InChI=1S/C13H26N4OS.HI/c1-5-7-14-13(15-8-10-19-9-6-2)16-11-12(18)17(3)4;/h6H,2,5,7-11H2,1,3-4H3,(H2,14,15,16);1H |
| InChIKey | PECSYWLOHBUIKP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|