C11H23IN4OS — CID 111343722
N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111343722) has the molecular formula C11H23IN4OS and a molecular weight of 386.30 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111343722 |
| Molecular Formula | C11H23IN4OS |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCCSC.I |
| InChI | InChI=1S/C11H22N4OS.HI/c1-5-6-12-11(13-7-8-17-4)14-9-10(16)15(2)3;/h5H,1,6-9H2,2-4H3,(H2,12,13,14);1H |
| InChIKey | CGGNYXMEBVLLOP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|