C15H30IN5O3 — CID 111363838
tert-butyl N-[2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111363838) has the molecular formula C15H30IN5O3 and a molecular weight of 455.34 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111363838 |
| Molecular Formula | C15H30IN5O3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | tert-butyl N-[2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C15H29N5O3.HI/c1-7-8-16-13(19-11-12(21)20(5)6)17-9-10-18-14(22)23-15(2,3)4;/h7H,1,8-11H2,2-6H3,(H,18,22)(H2,16,17,19);1H |
| InChIKey | GSKZSYAHPQGQEE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|