C16H34IN5O4 — CID 111544502
tert-butyl N-[3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111544502) has the molecular formula C16H34IN5O4 and a molecular weight of 487.38 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111544502 |
| Molecular Formula | C16H34IN5O4 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | tert-butyl N-[3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C16H33N5O4.HI/c1-16(2,3)25-15(23)19-9-7-8-17-14(18-10-11-24-6)20-12-13(22)21(4)5;/h7-12H2,1-6H3,(H,19,23)(H2,17,18,20);1H |
| InChIKey | GCYWIPDUUKJEGF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|