C18H30BrIN4O2S — CID 111544622
2-[[[[2-(4-bromophenyl)sulfanyl-2-methylpropyl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111544622) has the molecular formula C18H30BrIN4O2S and a molecular weight of 573.34 g/mol. Its IUPAC name is 2-[[[[2-(4-bromophenyl)sulfanyl-2-methylpropyl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[2-(4-bromophenyl)sulfanyl-2-methylpropyl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111544622 |
| Molecular Formula | C18H30BrIN4O2S |
| Molecular Weight | 573.34 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | 2-[[[[2-(4-bromophenyl)sulfanyl-2-methylpropyl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)NCC(C)(C)Sc1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H29BrN4O2S.HI/c1-18(2,26-15-8-6-14(19)7-9-15)13-22-17(20-10-11-25-5)21-12-16(24)23(3)4;/h6-9H,10-13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | WFAFYOGVBPCPPA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|