C17H28BrIN4OS — CID 111527736
N-[2-[[N'-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111527736) has the molecular formula C17H28BrIN4OS and a molecular weight of 543.31 g/mol. Its IUPAC name is N-[2-[[N'-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | N-[2-[[N'-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111527736 |
| Molecular Formula | C17H28BrIN4OS |
| Molecular Weight | 543.31 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | N-[2-[[N'-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)Sc1ccc(Br)cc1)NCCNC(C)=O.I |
| InChI | InChI=1S/C17H27BrN4OS.HI/c1-5-19-16(21-11-10-20-13(2)23)22-12-17(3,4)24-15-8-6-14(18)7-9-15;/h6-9H,5,10-12H2,1-4H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | KXEZPLBGLPTNEA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|