C19H32N4O — CID 111694390
N-[2-[[N-ethyl-N'-(2-ethyl-2-phenylbutyl)carbamimidoyl]amino]ethyl]acetamide (PubChem CID 111694390) has the molecular formula C19H32N4O and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-ethyl-2-phenylbutyl)carbamimidoyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-ethyl-2-phenylbutyl)carbamimidoyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 111694390 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-ethyl-2-phenylbutyl)carbamimidoyl]amino]ethyl]acetamide |
| SMILES | CCN/C(=N\CC(CC)(CC)c1ccccc1)NCCNC(C)=O |
| InChI | InChI=1S/C19H32N4O/c1-5-19(6-2,17-11-9-8-10-12-17)15-23-18(20-7-3)22-14-13-21-16(4)24/h8-12H,5-7,13-15H2,1-4H3,(H,21,24)(H2,20,22,23) |
| InChIKey | QUTTWTGSYDHNCU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|