C25H44IN5O — CID 111694397
1-[4-[[N-ethyl-N'-(2-ethyl-2-phenylbutyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111694397) has the molecular formula C25H44IN5O and a molecular weight of 557.57 g/mol. Its IUPAC name is 1-[4-[[N-ethyl-N'-(2-ethyl-2-phenylbutyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[N-ethyl-N'-(2-ethyl-2-phenylbutyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111694397 |
| Molecular Formula | C25H44IN5O |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 1-[4-[[N-ethyl-N'-(2-ethyl-2-phenylbutyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)c1ccccc1)NCCCCN1CCC(C(N)=O)CC1.I |
| InChI | InChI=1S/C25H43N5O.HI/c1-4-25(5-2,22-12-8-7-9-13-22)20-29-24(27-6-3)28-16-10-11-17-30-18-14-21(15-19-30)23(26)31;/h7-9,12-13,21H,4-6,10-11,14-20H2,1-3H3,(H2,26,31)(H2,27,28,29);1H |
| InChIKey | HJQGHLCHZZFSIB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|