C22H38IN5O — CID 111937942
1-[4-[[N'-[(2,4-dimethylphenyl)methyl]-N-ethylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111937942) has the molecular formula C22H38IN5O and a molecular weight of 515.48 g/mol. Its IUPAC name is 1-[4-[[N'-[(2,4-dimethylphenyl)methyl]-N-ethylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[N'-[(2,4-dimethylphenyl)methyl]-N-ethylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111937942 |
| Molecular Formula | C22H38IN5O |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 1-[4-[[N'-[(2,4-dimethylphenyl)methyl]-N-ethylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1C)NCCCCN1CCC(C(N)=O)CC1.I |
| InChI | InChI=1S/C22H37N5O.HI/c1-4-24-22(26-16-20-8-7-17(2)15-18(20)3)25-11-5-6-12-27-13-9-19(10-14-27)21(23)28;/h7-8,15,19H,4-6,9-14,16H2,1-3H3,(H2,23,28)(H2,24,25,26);1H |
| InChIKey | ISIKVQODOLVHFR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|