C23H39FIN5O — CID 111625685
1-[4-[[N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111625685) has the molecular formula C23H39FIN5O and a molecular weight of 547.50 g/mol. Its IUPAC name is 1-[4-[[N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111625685 |
| Molecular Formula | C23H39FIN5O |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 1-[4-[[N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(F)c1)NCCCCN1CCC(C(N)=O)CC1.I |
| InChI | InChI=1S/C23H38FN5O.HI/c1-4-26-22(28-17-23(2,3)19-8-7-9-20(24)16-19)27-12-5-6-13-29-14-10-18(11-15-29)21(25)30;/h7-9,16,18H,4-6,10-15,17H2,1-3H3,(H2,25,30)(H2,26,27,28);1H |
| InChIKey | WMCSUSBHWKFPLU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|