C23H34FIN4O — CID 111625741
1-ethyl-2-[2-(3-fluorophenyl)-2-methylpropyl]-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine;hydroiodide (PubChem CID 111625741) has the molecular formula C23H34FIN4O and a molecular weight of 528.45 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-fluorophenyl)-2-methylpropyl]-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-fluorophenyl)-2-methylpropyl]-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111625741 |
| Molecular Formula | C23H34FIN4O |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 1-ethyl-2-[2-(3-fluorophenyl)-2-methylpropyl]-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(F)c1)NCCCCn1c(C)cccc1=O.I |
| InChI | InChI=1S/C23H33FN4O.HI/c1-5-25-22(27-17-23(3,4)19-11-9-12-20(24)16-19)26-14-6-7-15-28-18(2)10-8-13-21(28)29;/h8-13,16H,5-7,14-15,17H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | XONLEVVAQAZHSF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|