C22H32FIN4O — CID 111624903
1-ethyl-2-[2-(3-fluorophenyl)-2-methylpropyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide (PubChem CID 111624903) has the molecular formula C22H32FIN4O and a molecular weight of 514.43 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-fluorophenyl)-2-methylpropyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-fluorophenyl)-2-methylpropyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111624903 |
| Molecular Formula | C22H32FIN4O |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 1-ethyl-2-[2-(3-fluorophenyl)-2-methylpropyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(F)c1)NCCCCn1ccccc1=O.I |
| InChI | InChI=1S/C22H31FN4O.HI/c1-4-24-21(25-13-6-8-15-27-14-7-5-12-20(27)28)26-17-22(2,3)18-10-9-11-19(23)16-18;/h5,7,9-12,14,16H,4,6,8,13,15,17H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | FIBVDCPLHSEICY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|