C21H37FIN5 — CID 111625465
1-ethyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-2-[2-(3-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 111625465) has the molecular formula C21H37FIN5 and a molecular weight of 505.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-2-[2-(3-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-2-[2-(3-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111625465 |
| Molecular Formula | C21H37FIN5 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-2-[2-(3-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(F)c1)NCCN1CCN(CC)CC1.I |
| InChI | InChI=1S/C21H36FN5.HI/c1-5-23-20(24-10-11-27-14-12-26(6-2)13-15-27)25-17-21(3,4)18-8-7-9-19(22)16-18;/h7-9,16H,5-6,10-15,17H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | MLVWEAYYKAPECJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|