C19H32FIN4O — CID 111187538
1-ethyl-2-[2-(4-fluorophenyl)-2-methylpropyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111187538) has the molecular formula C19H32FIN4O and a molecular weight of 478.39 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-fluorophenyl)-2-methylpropyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-methylpropyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111187538 |
| Molecular Formula | C19H32FIN4O |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-methylpropyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(F)cc1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C19H31FN4O.HI/c1-4-21-18(22-9-10-24-11-13-25-14-12-24)23-15-19(2,3)16-5-7-17(20)8-6-16;/h5-8H,4,9-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | KCVNNYLZGFQSKA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|