C22H33FIN5OS — CID 111654991
1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111654991) has the molecular formula C22H33FIN5OS and a molecular weight of 561.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654991 |
| Molecular Formula | C22H33FIN5OS |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCCN1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C22H32FN5OS.HI/c1-3-24-21(26-17-22(2,29)18-8-15-30-16-18)25-9-10-27-11-13-28(14-12-27)20-6-4-19(23)5-7-20;/h4-8,15-16,29H,3,9-14,17H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | ZEJZJZSMSCBBSS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|