C19H32FIN6O — CID 111365844
2-[[ethylamino-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111365844) has the molecular formula C19H32FIN6O and a molecular weight of 506.41 g/mol. Its IUPAC name is 2-[[ethylamino-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111365844 |
| Molecular Formula | C19H32FIN6O |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 2-[[ethylamino-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCCN1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C19H31FN6O.HI/c1-4-21-19(23-15-18(27)24(2)3)22-9-10-25-11-13-26(14-12-25)17-7-5-16(20)6-8-17;/h5-8H,4,9-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | JGNIPLIOLSRZCI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|