C21H32FN7 — CID 111906015
1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111906015) has the molecular formula C21H32FN7 and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111906015 |
| Molecular Formula | C21H32FN7 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H32FN7/c1-2-23-21(24-9-3-12-29-13-4-10-26-29)25-11-14-27-15-17-28(18-16-27)20-7-5-19(22)6-8-20/h4-8,10,13H,2-3,9,11-12,14-18H2,1H3,(H2,23,24,25) |
| InChIKey | AWDNOWWHCJCMKO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|