C18H26FIN6 — CID 111165344
N-ethyl-4-(4-fluorophenyl)-N'-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111165344) has the molecular formula C18H26FIN6 and a molecular weight of 472.35 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenyl)-N'-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(4-fluorophenyl)-N'-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111165344 |
| Molecular Formula | C18H26FIN6 |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N-ethyl-4-(4-fluorophenyl)-N'-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCn1cccn1)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C18H25FN6.HI/c1-2-20-18(21-9-11-25-10-3-8-22-25)24-14-12-23(13-15-24)17-6-4-16(19)5-7-17;/h3-8,10H,2,9,11-15H2,1H3,(H,20,21);1H |
| InChIKey | QUJHORKPIMCECC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|