C20H29FIN5O2 — CID 111500162
N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111500162) has the molecular formula C20H29FIN5O2 and a molecular weight of 517.39 g/mol. Its IUPAC name is N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111500162 |
| Molecular Formula | C20H29FIN5O2 |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCN1C(=O)CCCC1=O)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C20H28FN5O2.HI/c1-2-22-20(23-10-11-26-18(27)4-3-5-19(26)28)25-14-12-24(13-15-25)17-8-6-16(21)7-9-17;/h6-9H,2-5,10-15H2,1H3,(H,22,23);1H |
| InChIKey | LJSGSMHNGGRUDY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|