C18H28FIN4O2 — CID 111165026
methyl 3-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-2-methylpropanoate;hydroiodide (PubChem CID 111165026) has the molecular formula C18H28FIN4O2 and a molecular weight of 478.35 g/mol. Its IUPAC name is methyl 3-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 111165026 |
| Molecular Formula | C18H28FIN4O2 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | methyl 3-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-2-methylpropanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C(=O)OC)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C18H27FN4O2.HI/c1-4-20-18(21-13-14(2)17(24)25-3)23-11-9-22(10-12-23)16-7-5-15(19)6-8-16;/h5-8,14H,4,9-13H2,1-3H3,(H,20,21);1H |
| InChIKey | CYRPUVAOGMXYTO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|