C12H24IN3O2 — CID 110956293
methyl 3-[[ethylamino(pyrrolidin-1-yl)methylidene]amino]-2-methylpropanoate;hydroiodide (PubChem CID 110956293) has the molecular formula C12H24IN3O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is methyl 3-[[ethylamino(pyrrolidin-1-yl)methylidene]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[ethylamino(pyrrolidin-1-yl)methylidene]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 110956293 |
| Molecular Formula | C12H24IN3O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | methyl 3-[[ethylamino(pyrrolidin-1-yl)methylidene]amino]-2-methylpropanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C(=O)OC)N1CCCC1.I |
| InChI | InChI=1S/C12H23N3O2.HI/c1-4-13-12(15-7-5-6-8-15)14-9-10(2)11(16)17-3;/h10H,4-9H2,1-3H3,(H,13,14);1H |
| InChIKey | ZUENLAFXAVPJFC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|