C14H29IN4O3 — CID 111163644
ethyl 4-[N-ethyl-N'-(3-hydroxy-2-methylpropyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111163644) has the molecular formula C14H29IN4O3 and a molecular weight of 428.32 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-(3-hydroxy-2-methylpropyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-(3-hydroxy-2-methylpropyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111163644 |
| Molecular Formula | C14H29IN4O3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-(3-hydroxy-2-methylpropyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)CO)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C14H28N4O3.HI/c1-4-15-13(16-10-12(3)11-19)17-6-8-18(9-7-17)14(20)21-5-2;/h12,19H,4-11H2,1-3H3,(H,15,16);1H |
| InChIKey | VSBONXBOGLSLEO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|