C14H29IN4O4S — CID 111162745
ethyl 4-[N-ethyl-N'-(3-methylsulfonylpropyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111162745) has the molecular formula C14H29IN4O4S and a molecular weight of 476.38 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-(3-methylsulfonylpropyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-(3-methylsulfonylpropyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111162745 |
| Molecular Formula | C14H29IN4O4S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-(3-methylsulfonylpropyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCS(C)(=O)=O)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C14H28N4O4S.HI/c1-4-15-13(16-7-6-12-23(3,20)21)17-8-10-18(11-9-17)14(19)22-5-2;/h4-12H2,1-3H3,(H,15,16);1H |
| InChIKey | AMLTXZCKMBBISD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|