C19H38N6O2 — CID 111163404
ethyl 4-[N-ethyl-N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163404) has the molecular formula C19H38N6O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-ethyl-N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163404 |
| Molecular Formula | C19H38N6O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCCN1CCCN(C)CC1)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H38N6O2/c1-4-20-18(24-14-16-25(17-15-24)19(26)27-5-2)21-8-6-10-23-11-7-9-22(3)12-13-23/h4-17H2,1-3H3,(H,20,21) |
| InChIKey | YFDJPIYPUBPDQB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|