C22H37FN6 — CID 111165309
N-ethyl-4-(4-fluorophenyl)-N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111165309) has the molecular formula C22H37FN6 and a molecular weight of 404.58 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenyl)-N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-fluorophenyl)-N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165309 |
| Molecular Formula | C22H37FN6 |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | N-ethyl-4-(4-fluorophenyl)-N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1CCCN(C)CC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H37FN6/c1-3-24-22(25-10-4-12-27-13-5-11-26(2)14-15-27)29-18-16-28(17-19-29)21-8-6-20(23)7-9-21/h6-9H,3-5,10-19H2,1-2H3,(H,24,25) |
| InChIKey | KHIHPSRMYAQSKM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|