C23H37FN6O — CID 111165291
1-[3-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 111165291) has the molecular formula C23H37FN6O and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-[3-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111165291 |
| Molecular Formula | C23H37FN6O |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 1-[3-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H37FN6O/c1-4-25-23(26-12-6-14-29-13-5-7-21(29)22(31)27(2)3)30-17-15-28(16-18-30)20-10-8-19(24)9-11-20/h8-11,21H,4-7,12-18H2,1-3H3,(H,25,26) |
| InChIKey | FLQZHSFMGBJAMF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|