C23H38FIN6O — CID 111148576
1-[3-[[ethylamino-[4-(2-fluorophenyl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide (PubChem CID 111148576) has the molecular formula C23H38FIN6O and a molecular weight of 560.50 g/mol. Its IUPAC name is 1-[3-[[ethylamino-[4-(2-fluorophenyl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[ethylamino-[4-(2-fluorophenyl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111148576 |
| Molecular Formula | C23H38FIN6O |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 1-[3-[[ethylamino-[4-(2-fluorophenyl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C23H37FN6O.HI/c1-4-25-23(26-12-8-14-28-13-7-11-21(28)22(31)27(2)3)30-17-15-29(16-18-30)20-10-6-5-9-19(20)24;/h5-6,9-10,21H,4,7-8,11-18H2,1-3H3,(H,25,26);1H |
| InChIKey | AVUFSKRQCIXZFE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|