C25H42IN5O2 — CID 111527670
1-[3-[[ethylamino-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide (PubChem CID 111527670) has the molecular formula C25H42IN5O2 and a molecular weight of 571.55 g/mol. Its IUPAC name is 1-[3-[[ethylamino-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[ethylamino-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111527670 |
| Molecular Formula | C25H42IN5O2 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 1-[3-[[ethylamino-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)N1CCC(COCc2ccccc2)C1.I |
| InChI | InChI=1S/C25H41N5O2.HI/c1-4-26-25(27-14-9-16-29-15-8-12-23(29)24(31)28(2)3)30-17-13-22(18-30)20-32-19-21-10-6-5-7-11-21;/h5-7,10-11,22-23H,4,8-9,12-20H2,1-3H3,(H,26,27);1H |
| InChIKey | HTNVWCCCQOQGFD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|