C25H42N4O — CID 111527553
N-ethyl-N'-[4-(3-methylpiperidin-1-yl)butyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111527553) has the molecular formula C25H42N4O and a molecular weight of 414.64 g/mol. Its IUPAC name is N-ethyl-N'-[4-(3-methylpiperidin-1-yl)butyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[4-(3-methylpiperidin-1-yl)butyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111527553 |
| Molecular Formula | C25H42N4O |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.34 |
| IUPAC Name | N-ethyl-N'-[4-(3-methylpiperidin-1-yl)butyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN1CCCC(C)C1)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C25H42N4O/c1-3-26-25(27-14-7-8-15-28-16-9-10-22(2)18-28)29-17-13-24(19-29)21-30-20-23-11-5-4-6-12-23/h4-6,11-12,22,24H,3,7-10,13-21H2,1-2H3,(H,26,27) |
| InChIKey | BTAISXRHCOVCEL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|