C23H38N4O2 — CID 111527549
N-ethyl-N'-[3-(4-hydroxypiperidin-1-yl)propyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111527549) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is N-ethyl-N'-[3-(4-hydroxypiperidin-1-yl)propyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(4-hydroxypiperidin-1-yl)propyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111527549 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | N-ethyl-N'-[3-(4-hydroxypiperidin-1-yl)propyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1CCC(O)CC1)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C23H38N4O2/c1-2-24-23(25-12-6-13-26-14-10-22(28)11-15-26)27-16-9-21(17-27)19-29-18-20-7-4-3-5-8-20/h3-5,7-8,21-22,28H,2,6,9-19H2,1H3,(H,24,25) |
| InChIKey | BOHLBJHJDXFPEN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|