C24H38IN5O — CID 111263942
1-[3-[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide (PubChem CID 111263942) has the molecular formula C24H38IN5O and a molecular weight of 539.51 g/mol. Its IUPAC name is 1-[3-[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111263942 |
| Molecular Formula | C24H38IN5O |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 1-[3-[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)N1CC=C(c2ccccc2)CC1.I |
| InChI | InChI=1S/C24H37N5O.HI/c1-4-25-24(29-18-13-21(14-19-29)20-10-6-5-7-11-20)26-15-9-17-28-16-8-12-22(28)23(30)27(2)3;/h5-7,10-11,13,22H,4,8-9,12,14-19H2,1-3H3,(H,25,26);1H |
| InChIKey | HHXJNSRFCWHFSQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|