C22H34IN3O2 — CID 111263222
N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide (PubChem CID 111263222) has the molecular formula C22H34IN3O2 and a molecular weight of 499.44 g/mol. Its IUPAC name is N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111263222 |
| Molecular Formula | C22H34IN3O2 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCCO1)N1CC=C(c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H33N3O2.HI/c1-2-23-22(24-13-7-16-26-18-21-10-6-17-27-21)25-14-11-20(12-15-25)19-8-4-3-5-9-19;/h3-5,8-9,11,21H,2,6-7,10,12-18H2,1H3,(H,23,24);1H |
| InChIKey | BKQHSPHOEBSHKS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|