C24H39N5 — CID 111263811
N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 111263811) has the molecular formula C24H39N5 and a molecular weight of 397.61 g/mol. Its IUPAC name is N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 111263811 |
| Molecular Formula | C24H39N5 |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN1CCN(CC)CC1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H39N5/c1-3-25-24(26-14-8-9-15-28-20-18-27(4-2)19-21-28)29-16-12-23(13-17-29)22-10-6-5-7-11-22/h5-7,10-12H,3-4,8-9,13-21H2,1-2H3,(H,25,26) |
| InChIKey | TUIAKNKJNZXQCE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|