C24H42N6 — CID 110959693
4-benzyl-N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]piperazine-1-carboximidamide (PubChem CID 110959693) has the molecular formula C24H42N6 and a molecular weight of 414.64 g/mol. Its IUPAC name is 4-benzyl-N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]piperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110959693 |
| Molecular Formula | C24H42N6 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | 4-benzyl-N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN1CCN(CC)CC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H42N6/c1-3-25-24(26-12-8-9-13-28-16-14-27(4-2)15-17-28)30-20-18-29(19-21-30)22-23-10-6-5-7-11-23/h5-7,10-11H,3-4,8-9,12-22H2,1-2H3,(H,25,26) |
| InChIKey | GNFDMSLIPJQPPU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|