C20H36IN5O2S — CID 110960554
4-benzyl-N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 110960554) has the molecular formula C20H36IN5O2S and a molecular weight of 537.51 g/mol. Its IUPAC name is 4-benzyl-N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzyl-N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110960554 |
| Molecular Formula | C20H36IN5O2S |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 4-benzyl-N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)N1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C20H35N5O2S.HI/c1-4-21-20(22-12-9-13-25(5-2)28(3,26)27)24-16-14-23(15-17-24)18-19-10-7-6-8-11-19;/h6-8,10-11H,4-5,9,12-18H2,1-3H3,(H,21,22);1H |
| InChIKey | AVAFVJSQXALNKM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|