C21H37N5O2S — CID 110987534
1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine (PubChem CID 110987534) has the molecular formula C21H37N5O2S and a molecular weight of 423.63 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 110987534 |
| Molecular Formula | C21H37N5O2S |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H37N5O2S/c1-4-22-21(23-14-9-15-26(5-2)29(3,27)28)24-20-12-16-25(17-13-20)18-19-10-7-6-8-11-19/h6-8,10-11,20H,4-5,9,12-18H2,1-3H3,(H2,22,23,24) |
| InChIKey | JDINBIZTQBWWKD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|