C16H28IN5O2S — CID 110960578
4-benzyl-N-ethyl-N'-(2-sulfamoylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 110960578) has the molecular formula C16H28IN5O2S and a molecular weight of 481.40 g/mol. Its IUPAC name is 4-benzyl-N-ethyl-N'-(2-sulfamoylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzyl-N-ethyl-N'-(2-sulfamoylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110960578 |
| Molecular Formula | C16H28IN5O2S |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 4-benzyl-N-ethyl-N'-(2-sulfamoylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)N1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C16H27N5O2S.HI/c1-2-18-16(19-8-13-24(17,22)23)21-11-9-20(10-12-21)14-15-6-4-3-5-7-15;/h3-7H,2,8-14H2,1H3,(H,18,19)(H2,17,22,23);1H |
| InChIKey | VXDFNCJSFYLEKR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|