C18H32N6O2S — CID 111220173
N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111220173) has the molecular formula C18H32N6O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111220173 |
| Molecular Formula | C18H32N6O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H32N6O2S/c1-4-19-18(21-11-8-12-24(5-2)27(3,25)26)23-15-13-22(14-16-23)17-9-6-7-10-20-17/h6-7,9-10H,4-5,8,11-16H2,1-3H3,(H,19,21) |
| InChIKey | WFBRYFRXRHOMCJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|