C13H28N4O2S — CID 110956756
N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]pyrrolidine-1-carboximidamide (PubChem CID 110956756) has the molecular formula C13H28N4O2S and a molecular weight of 304.46 g/mol. Its IUPAC name is N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110956756 |
| Molecular Formula | C13H28N4O2S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)N1CCCC1 |
| InChI | InChI=1S/C13H28N4O2S/c1-4-14-13(16-10-6-7-11-16)15-9-8-12-17(5-2)20(3,18)19/h4-12H2,1-3H3,(H,14,15) |
| InChIKey | OGFQLKJNHINSMA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|