C17H35N5O3S — CID 111726415
N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111726415) has the molecular formula C17H35N5O3S and a molecular weight of 389.57 g/mol. Its IUPAC name is N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111726415 |
| Molecular Formula | C17H35N5O3S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C17H35N5O3S/c1-4-18-17(19-8-6-9-22(5-2)26(3,23)24)21-10-7-16(15-21)20-11-13-25-14-12-20/h16H,4-15H2,1-3H3,(H,18,19) |
| InChIKey | YNUCANJETJYZMY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|