C21H40N6O2 — CID 111728393
1-[3-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 111728393) has the molecular formula C21H40N6O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[3-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111728393 |
| Molecular Formula | C21H40N6O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | 1-[3-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C21H40N6O2/c1-4-22-21(27-12-8-18(17-27)25-13-15-29-16-14-25)23-9-6-11-26-10-5-7-19(26)20(28)24(2)3/h18-19H,4-17H2,1-3H3,(H,22,23) |
| InChIKey | MVZHZKUICVPOEF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|