C17H33N5O3S — CID 111726843
N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111726843) has the molecular formula C17H33N5O3S and a molecular weight of 387.55 g/mol. Its IUPAC name is N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111726843 |
| Molecular Formula | C17H33N5O3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C17H33N5O3S/c1-2-18-17(19-4-6-20-9-13-26(23,24)14-10-20)22-5-3-16(15-22)21-7-11-25-12-8-21/h16H,2-15H2,1H3,(H,18,19) |
| InChIKey | MYFHNQMCUZQGEI-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|