C19H38N6O — CID 111728063
N-ethyl-N'-[2-(4-methylpiperazin-1-yl)propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111728063) has the molecular formula C19H38N6O and a molecular weight of 366.55 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-methylpiperazin-1-yl)propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-methylpiperazin-1-yl)propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111728063 |
| Molecular Formula | C19H38N6O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | N-ethyl-N'-[2-(4-methylpiperazin-1-yl)propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)N1CCN(C)CC1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C19H38N6O/c1-4-20-19(21-15-17(2)23-9-7-22(3)8-10-23)25-6-5-18(16-25)24-11-13-26-14-12-24/h17-18H,4-16H2,1-3H3,(H,20,21) |
| InChIKey | TUQBRNWAFMKKLN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 46.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|