C24H40N6O — CID 111726513
N-ethyl-3-morpholin-4-yl-N'-[2-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111726513) has the molecular formula C24H40N6O and a molecular weight of 428.63 g/mol. Its IUPAC name is N-ethyl-3-morpholin-4-yl-N'-[2-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-morpholin-4-yl-N'-[2-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111726513 |
| Molecular Formula | C24H40N6O |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | N-ethyl-3-morpholin-4-yl-N'-[2-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)N1CCN(c2ccccc2)CC1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C24H40N6O/c1-3-25-24(30-10-9-23(20-30)29-15-17-31-18-16-29)26-19-21(2)27-11-13-28(14-12-27)22-7-5-4-6-8-22/h4-8,21,23H,3,9-20H2,1-2H3,(H,25,26) |
| InChIKey | KGPGWFNKTUUGAF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|