C24H37N7 — CID 111741274
N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[2-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111741274) has the molecular formula C24H37N7 and a molecular weight of 423.61 g/mol. Its IUPAC name is N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[2-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[2-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111741274 |
| Molecular Formula | C24H37N7 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[2-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)N1CCN(c2ccccc2)CC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C24H37N7/c1-4-25-24(31-11-10-21(19-31)22-17-27-28(3)18-22)26-16-20(2)29-12-14-30(15-13-29)23-8-6-5-7-9-23/h5-9,17-18,20-21H,4,10-16,19H2,1-3H3,(H,25,26) |
| InChIKey | GHJRFLGMYQFXNN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|