C23H36FN5O2 — CID 111728707
N-ethyl-N'-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111728707) has the molecular formula C23H36FN5O2 and a molecular weight of 433.57 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111728707 |
| Molecular Formula | C23H36FN5O2 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | N-ethyl-N'-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(c1ccc(F)cc1)N1CCOCC1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C23H36FN5O2/c1-2-25-23(29-8-7-21(18-29)27-9-13-30-14-10-27)26-17-22(28-11-15-31-16-12-28)19-3-5-20(24)6-4-19/h3-6,21-22H,2,7-18H2,1H3,(H,25,26) |
| InChIKey | KPMUFNWPYTWRCW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|