C19H27FN4O — CID 111996129
3-(2,5-dihydropyrrol-1-yl)-N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidine-1-carboximidamide (PubChem CID 111996129) has the molecular formula C19H27FN4O and a molecular weight of 346.45 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-yl)-N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(2,5-dihydropyrrol-1-yl)-N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111996129 |
| Molecular Formula | C19H27FN4O |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-yl)-N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)N1CCC(N2CC=CC2)C1 |
| InChI | InChI=1S/C19H27FN4O/c1-2-21-19(22-13-18(25)15-5-7-16(20)8-6-15)24-12-9-17(14-24)23-10-3-4-11-23/h3-8,17-18,25H,2,9-14H2,1H3,(H,21,22) |
| InChIKey | WNJADTTWXJUHSA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|